2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid

C7H8N2O3 — CID 96632535

IUPAC2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid
SMILESO=C(O)Cc1cnc2n1CCO2
InChIInChI=1S/C7H8N2O3/c10-6(11)3-5-4-8-7-9(5)1-2-12-7/h4H,1-3H2,(H,10,11)
InChIKeyPXTNWAQDQWXAJK-UHFFFAOYSA-N
MW168.15 g/mol
LogP-0.10
Rot. Bonds2

About 2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid

2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid (PubChem CID 96632535) has the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. Its IUPAC name is 2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid.

Molecular Properties

Compound Name2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid
PubChem CID96632535
Molecular FormulaC7H8N2O3
Molecular Weight168.15 g/mol
Exact Mass168.05
IUPAC Name2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid
SMILESO=C(O)Cc1cnc2n1CCO2
InChIInChI=1S/C7H8N2O3/c10-6(11)3-5-4-8-7-9(5)1-2-12-7/h4H,1-3H2,(H,10,11)
InChIKeyPXTNWAQDQWXAJK-UHFFFAOYSA-N
XLogP-0.10
TPSA64.35 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.15
LogP ≤ 5-0.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid?
The IUPAC name of 2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid (CID 96632535) is 2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid.
What is the SMILES notation for 2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid?
The canonical SMILES for 2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid is O=C(O)Cc1cnc2n1CCO2.
What is the InChIKey of 2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid?
The InChIKey is PXTNWAQDQWXAJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O3/c10-6(11)3-5-4-8-7-9(5)1-2-12-7/h4H,1-3H2,(H,10,11).
What are the key properties of 2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid?
2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid has a molecular weight of 168.15 g/mol, XLogP of -0.10, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid is sourced from PubChem (CID 96632535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).