About 2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid
2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid (PubChem CID 96632535) has the molecular formula C7H8N2O3
and a molecular weight of 168.15 g/mol. Its IUPAC name is 2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid.
Analyze 2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid?
The IUPAC name of 2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid (CID 96632535) is 2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid.
What is the SMILES notation for 2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid?
The canonical SMILES for 2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid is O=C(O)Cc1cnc2n1CCO2.
What is the InChIKey of 2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid?
The InChIKey is PXTNWAQDQWXAJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O3/c10-6(11)3-5-4-8-7-9(5)1-2-12-7/h4H,1-3H2,(H,10,11).
What are the key properties of 2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid?
2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid has a molecular weight of 168.15 g/mol, XLogP of -0.10, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydroimidazo[2,1-b][1,3]oxazol-5-yl)acetic acid is sourced from PubChem (CID 96632535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).