C13H15N3O3 — CID 116854629
2-[6-(oxan-4-yl)imidazo[1,2-b]pyridazin-3-yl]acetic acid (PubChem CID 116854629) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-[6-(oxan-4-yl)imidazo[1,2-b]pyridazin-3-yl]acetic acid.
| Compound Name | 2-[6-(oxan-4-yl)imidazo[1,2-b]pyridazin-3-yl]acetic acid |
|---|---|
| PubChem CID | 116854629 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2-[6-(oxan-4-yl)imidazo[1,2-b]pyridazin-3-yl]acetic acid |
| SMILES | O=C(O)Cc1cnc2ccc(C3CCOCC3)nn12 |
| InChI | InChI=1S/C13H15N3O3/c17-13(18)7-10-8-14-12-2-1-11(15-16(10)12)9-3-5-19-6-4-9/h1-2,8-9H,3-7H2,(H,17,18) |
| InChIKey | DSBNQWOCWVPDRS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |