C11H12N2O3S — CID 104752238
2-[6-(oxolan-3-yl)imidazo[2,1-b][1,3]thiazol-3-yl]acetic acid (PubChem CID 104752238) has the molecular formula C11H12N2O3S and a molecular weight of 252.29 g/mol. Its IUPAC name is 2-[6-(oxolan-3-yl)imidazo[2,1-b][1,3]thiazol-3-yl]acetic acid.
| Compound Name | 2-[6-(oxolan-3-yl)imidazo[2,1-b][1,3]thiazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 104752238 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 2-[6-(oxolan-3-yl)imidazo[2,1-b][1,3]thiazol-3-yl]acetic acid |
| SMILES | O=C(O)Cc1csc2nc(C3CCOC3)cn12 |
| InChI | InChI=1S/C11H12N2O3S/c14-10(15)3-8-6-17-11-12-9(4-13(8)11)7-1-2-16-5-7/h4,6-7H,1-3,5H2,(H,14,15) |
| InChIKey | HKRAEAJKONMXNL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |