C7H8BrNOS — CID 104756423
2-bromo-4-(oxolan-3-yl)-1,3-thiazole (PubChem CID 104756423) has the molecular formula C7H8BrNOS and a molecular weight of 234.12 g/mol. Its IUPAC name is 2-bromo-4-(oxolan-3-yl)-1,3-thiazole.
| Compound Name | 2-bromo-4-(oxolan-3-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 104756423 |
| Molecular Formula | C7H8BrNOS |
| Molecular Weight | 234.12 g/mol |
| Exact Mass | 232.95 |
| IUPAC Name | 2-bromo-4-(oxolan-3-yl)-1,3-thiazole |
| SMILES | Brc1nc(C2CCOC2)cs1 |
| InChI | InChI=1S/C7H8BrNOS/c8-7-9-6(4-11-7)5-1-2-10-3-5/h4-5H,1-3H2 |
| InChIKey | ICWAJOGZWAAXFI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.12 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |