C10H12N4OS — CID 104749835
4-[4-(oxolan-3-yl)-1,3-thiazol-2-yl]-1H-pyrazol-5-amine (PubChem CID 104749835) has the molecular formula C10H12N4OS and a molecular weight of 236.30 g/mol. Its IUPAC name is 4-[4-(oxolan-3-yl)-1,3-thiazol-2-yl]-1H-pyrazol-5-amine.
| Compound Name | 4-[4-(oxolan-3-yl)-1,3-thiazol-2-yl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 104749835 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 4-[4-(oxolan-3-yl)-1,3-thiazol-2-yl]-1H-pyrazol-5-amine |
| SMILES | Nc1[nH]ncc1-c1nc(C2CCOC2)cs1 |
| InChI | InChI=1S/C10H12N4OS/c11-9-7(3-12-14-9)10-13-8(5-16-10)6-1-2-15-4-6/h3,5-6H,1-2,4H2,(H3,11,12,14) |
| InChIKey | GQAVXNJQMHDRCC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrazole_amino_B(1)', 'substructure': 'N/A'} |
|---|