C7H11N3OS — CID 104752360
[4-(oxolan-3-yl)-1,3-thiazol-2-yl]hydrazine (PubChem CID 104752360) has the molecular formula C7H11N3OS and a molecular weight of 185.25 g/mol. Its IUPAC name is [4-(oxolan-3-yl)-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [4-(oxolan-3-yl)-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 104752360 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | [4-(oxolan-3-yl)-1,3-thiazol-2-yl]hydrazine |
| SMILES | NNc1nc(C2CCOC2)cs1 |
| InChI | InChI=1S/C7H11N3OS/c8-10-7-9-6(4-12-7)5-1-2-11-3-5/h4-5H,1-3,8H2,(H,9,10) |
| InChIKey | BXMKLGCOGRNBEE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|