About [4-(oxolan-3-yl)-1,3-thiazol-2-yl]hydrazine
[4-(oxolan-3-yl)-1,3-thiazol-2-yl]hydrazine (PubChem CID 104752360) has the molecular formula C7H11N3OS
and a molecular weight of 185.25 g/mol. Its IUPAC name is [4-(oxolan-3-yl)-1,3-thiazol-2-yl]hydrazine.
Molecular Properties
| Compound Name | [4-(oxolan-3-yl)-1,3-thiazol-2-yl]hydrazine |
| PubChem CID | 104752360 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | [4-(oxolan-3-yl)-1,3-thiazol-2-yl]hydrazine |
| SMILES | NNc1nc(C2CCOC2)cs1 |
| InChI | InChI=1S/C7H11N3OS/c8-10-7-9-6(4-12-7)5-1-2-11-3-5/h4-5H,1-3,8H2,(H,9,10) |
| InChIKey | BXMKLGCOGRNBEE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-(oxolan-3-yl)-1,3-thiazol-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(oxolan-3-yl)-1,3-thiazol-2-yl]hydrazine?
The IUPAC name of [4-(oxolan-3-yl)-1,3-thiazol-2-yl]hydrazine (CID 104752360) is [4-(oxolan-3-yl)-1,3-thiazol-2-yl]hydrazine.
What is the SMILES notation for [4-(oxolan-3-yl)-1,3-thiazol-2-yl]hydrazine?
The canonical SMILES for [4-(oxolan-3-yl)-1,3-thiazol-2-yl]hydrazine is NNc1nc(C2CCOC2)cs1.
What is the InChIKey of [4-(oxolan-3-yl)-1,3-thiazol-2-yl]hydrazine?
The InChIKey is BXMKLGCOGRNBEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3OS/c8-10-7-9-6(4-12-7)5-1-2-11-3-5/h4-5H,1-3,8H2,(H,9,10).
What are the key properties of [4-(oxolan-3-yl)-1,3-thiazol-2-yl]hydrazine?
[4-(oxolan-3-yl)-1,3-thiazol-2-yl]hydrazine has a molecular weight of 185.25 g/mol, XLogP of 0.93, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(oxolan-3-yl)-1,3-thiazol-2-yl]hydrazine is sourced from PubChem (CID 104752360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).