C12H19NOS — CID 122142392
2-(3-methylbutyl)-4-(oxolan-3-yl)-1,3-thiazole (PubChem CID 122142392) has the molecular formula C12H19NOS and a molecular weight of 225.36 g/mol. Its IUPAC name is 2-(3-methylbutyl)-4-(oxolan-3-yl)-1,3-thiazole.
| Compound Name | 2-(3-methylbutyl)-4-(oxolan-3-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 122142392 |
| Molecular Formula | C12H19NOS |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-(3-methylbutyl)-4-(oxolan-3-yl)-1,3-thiazole |
| SMILES | CC(C)CCc1nc(C2CCOC2)cs1 |
| InChI | InChI=1S/C12H19NOS/c1-9(2)3-4-12-13-11(8-15-12)10-5-6-14-7-10/h8-10H,3-7H2,1-2H3 |
| InChIKey | BXKRTPMQJQNRTR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |