About 3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]butanoic acid
3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]butanoic acid (PubChem CID 116965749) has the molecular formula C12H17NO3S
and a molecular weight of 255.34 g/mol. Its IUPAC name is 3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]butanoic acid.
Molecular Properties
| Compound Name | 3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]butanoic acid |
| PubChem CID | 116965749 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]butanoic acid |
| SMILES | CC(CC(=O)O)c1nc(C2CCOCC2)cs1 |
| InChI | InChI=1S/C12H17NO3S/c1-8(6-11(14)15)12-13-10(7-17-12)9-2-4-16-5-3-9/h7-9H,2-6H2,1H3,(H,14,15) |
| InChIKey | BDFDSIFERFIJJT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]butanoic acid?
The IUPAC name of 3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]butanoic acid (CID 116965749) is 3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]butanoic acid.
What is the SMILES notation for 3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]butanoic acid?
The canonical SMILES for 3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]butanoic acid is CC(CC(=O)O)c1nc(C2CCOCC2)cs1.
What is the InChIKey of 3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]butanoic acid?
The InChIKey is BDFDSIFERFIJJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3S/c1-8(6-11(14)15)12-13-10(7-17-12)9-2-4-16-5-3-9/h7-9H,2-6H2,1H3,(H,14,15).
What are the key properties of 3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]butanoic acid?
3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]butanoic acid has a molecular weight of 255.34 g/mol, XLogP of 2.62, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]butanoic acid is sourced from PubChem (CID 116965749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).