C11H18N2O2S — CID 116969214
2-amino-3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]propan-1-ol (PubChem CID 116969214) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is 2-amino-3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]propan-1-ol.
| Compound Name | 2-amino-3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 116969214 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-amino-3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]propan-1-ol |
| SMILES | NC(CO)Cc1nc(C2CCOCC2)cs1 |
| InChI | InChI=1S/C11H18N2O2S/c12-9(6-14)5-11-13-10(7-16-11)8-1-3-15-4-2-8/h7-9,14H,1-6,12H2 |
| InChIKey | ZKOIYDJCNZMVNR-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |