2-(2-morpholin-4-yl-1,3-thiazol-5-yl)acetic acid

C9H12N2O3S — CID 82374896

IUPAC2-(2-morpholin-4-yl-1,3-thiazol-5-yl)acetic acid
SMILESO=C(O)Cc1cnc(N2CCOCC2)s1
InChIInChI=1S/C9H12N2O3S/c12-8(13)5-7-6-10-9(15-7)11-1-3-14-4-2-11/h6H,1-5H2,(H,12,13)
InChIKeyIOYFIKVRCFWNDT-UHFFFAOYSA-N
MW228.27 g/mol
LogP0.61
Rot. Bonds3

About 2-(2-morpholin-4-yl-1,3-thiazol-5-yl)acetic acid

2-(2-morpholin-4-yl-1,3-thiazol-5-yl)acetic acid (PubChem CID 82374896) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is 2-(2-morpholin-4-yl-1,3-thiazol-5-yl)acetic acid.

Molecular Properties

Compound Name2-(2-morpholin-4-yl-1,3-thiazol-5-yl)acetic acid
PubChem CID82374896
Molecular FormulaC9H12N2O3S
Molecular Weight228.27 g/mol
Exact Mass228.06
IUPAC Name2-(2-morpholin-4-yl-1,3-thiazol-5-yl)acetic acid
SMILESO=C(O)Cc1cnc(N2CCOCC2)s1
InChIInChI=1S/C9H12N2O3S/c12-8(13)5-7-6-10-9(15-7)11-1-3-14-4-2-11/h6H,1-5H2,(H,12,13)
InChIKeyIOYFIKVRCFWNDT-UHFFFAOYSA-N
XLogP0.61
TPSA62.66 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.27
LogP ≤ 50.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-(2-morpholin-4-yl-1,3-thiazol-5-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-morpholin-4-yl-1,3-thiazol-5-yl)acetic acid?
The IUPAC name of 2-(2-morpholin-4-yl-1,3-thiazol-5-yl)acetic acid (CID 82374896) is 2-(2-morpholin-4-yl-1,3-thiazol-5-yl)acetic acid.
What is the SMILES notation for 2-(2-morpholin-4-yl-1,3-thiazol-5-yl)acetic acid?
The canonical SMILES for 2-(2-morpholin-4-yl-1,3-thiazol-5-yl)acetic acid is O=C(O)Cc1cnc(N2CCOCC2)s1.
What is the InChIKey of 2-(2-morpholin-4-yl-1,3-thiazol-5-yl)acetic acid?
The InChIKey is IOYFIKVRCFWNDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3S/c12-8(13)5-7-6-10-9(15-7)11-1-3-14-4-2-11/h6H,1-5H2,(H,12,13).
What are the key properties of 2-(2-morpholin-4-yl-1,3-thiazol-5-yl)acetic acid?
2-(2-morpholin-4-yl-1,3-thiazol-5-yl)acetic acid has a molecular weight of 228.27 g/mol, XLogP of 0.61, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-morpholin-4-yl-1,3-thiazol-5-yl)acetic acid is sourced from PubChem (CID 82374896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).