C9H12N2O3S — CID 82374896
2-(2-morpholin-4-yl-1,3-thiazol-5-yl)acetic acid (PubChem CID 82374896) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is 2-(2-morpholin-4-yl-1,3-thiazol-5-yl)acetic acid.
| Compound Name | 2-(2-morpholin-4-yl-1,3-thiazol-5-yl)acetic acid |
|---|---|
| PubChem CID | 82374896 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 2-(2-morpholin-4-yl-1,3-thiazol-5-yl)acetic acid |
| SMILES | O=C(O)Cc1cnc(N2CCOCC2)s1 |
| InChI | InChI=1S/C9H12N2O3S/c12-8(13)5-7-6-10-9(15-7)11-1-3-14-4-2-11/h6H,1-5H2,(H,12,13) |
| InChIKey | IOYFIKVRCFWNDT-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |