About (2-pyrrolidin-1-yl-1,3-thiazol-5-yl)methanol
(2-pyrrolidin-1-yl-1,3-thiazol-5-yl)methanol (PubChem CID 62753317) has the molecular formula C8H12N2OS
and a molecular weight of 184.26 g/mol. Its IUPAC name is (2-pyrrolidin-1-yl-1,3-thiazol-5-yl)methanol.
Molecular Properties
| Compound Name | (2-pyrrolidin-1-yl-1,3-thiazol-5-yl)methanol |
| PubChem CID | 62753317 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (2-pyrrolidin-1-yl-1,3-thiazol-5-yl)methanol |
| SMILES | OCc1cnc(N2CCCC2)s1 |
| InChI | InChI=1S/C8H12N2OS/c11-6-7-5-9-8(12-7)10-3-1-2-4-10/h5,11H,1-4,6H2 |
| InChIKey | PQUQSBNCRFTOBK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-pyrrolidin-1-yl-1,3-thiazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-pyrrolidin-1-yl-1,3-thiazol-5-yl)methanol?
The IUPAC name of (2-pyrrolidin-1-yl-1,3-thiazol-5-yl)methanol (CID 62753317) is (2-pyrrolidin-1-yl-1,3-thiazol-5-yl)methanol.
What is the SMILES notation for (2-pyrrolidin-1-yl-1,3-thiazol-5-yl)methanol?
The canonical SMILES for (2-pyrrolidin-1-yl-1,3-thiazol-5-yl)methanol is OCc1cnc(N2CCCC2)s1.
What is the InChIKey of (2-pyrrolidin-1-yl-1,3-thiazol-5-yl)methanol?
The InChIKey is PQUQSBNCRFTOBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2OS/c11-6-7-5-9-8(12-7)10-3-1-2-4-10/h5,11H,1-4,6H2.
What are the key properties of (2-pyrrolidin-1-yl-1,3-thiazol-5-yl)methanol?
(2-pyrrolidin-1-yl-1,3-thiazol-5-yl)methanol has a molecular weight of 184.26 g/mol, XLogP of 1.24, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-pyrrolidin-1-yl-1,3-thiazol-5-yl)methanol is sourced from PubChem (CID 62753317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).