C8H12N2OS — CID 62753317
(2-pyrrolidin-1-yl-1,3-thiazol-5-yl)methanol (PubChem CID 62753317) has the molecular formula C8H12N2OS and a molecular weight of 184.26 g/mol. Its IUPAC name is (2-pyrrolidin-1-yl-1,3-thiazol-5-yl)methanol.
| Compound Name | (2-pyrrolidin-1-yl-1,3-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 62753317 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (2-pyrrolidin-1-yl-1,3-thiazol-5-yl)methanol |
| SMILES | OCc1cnc(N2CCCC2)s1 |
| InChI | InChI=1S/C8H12N2OS/c11-6-7-5-9-8(12-7)10-3-1-2-4-10/h5,11H,1-4,6H2 |
| InChIKey | PQUQSBNCRFTOBK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |