C13H21N3S — CID 118472763
5-(piperidin-1-ylmethyl)-2-pyrrolidin-1-yl-1,3-thiazole (PubChem CID 118472763) has the molecular formula C13H21N3S and a molecular weight of 251.40 g/mol. Its IUPAC name is 5-(piperidin-1-ylmethyl)-2-pyrrolidin-1-yl-1,3-thiazole.
| Compound Name | 5-(piperidin-1-ylmethyl)-2-pyrrolidin-1-yl-1,3-thiazole |
|---|---|
| PubChem CID | 118472763 |
| Molecular Formula | C13H21N3S |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 5-(piperidin-1-ylmethyl)-2-pyrrolidin-1-yl-1,3-thiazole |
| SMILES | c1nc(N2CCCC2)sc1CN1CCCCC1 |
| InChI | InChI=1S/C13H21N3S/c1-2-6-15(7-3-1)11-12-10-14-13(17-12)16-8-4-5-9-16/h10H,1-9,11H2 |
| InChIKey | SOPNYWRLTZAQII-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |