About [2-(azetidin-1-yl)-1,3-thiazol-5-yl]methanamine
[2-(azetidin-1-yl)-1,3-thiazol-5-yl]methanamine (PubChem CID 130548481) has the molecular formula C7H11N3S
and a molecular weight of 169.25 g/mol. Its IUPAC name is [2-(azetidin-1-yl)-1,3-thiazol-5-yl]methanamine.
Molecular Properties
| Compound Name | [2-(azetidin-1-yl)-1,3-thiazol-5-yl]methanamine |
| PubChem CID | 130548481 |
| Molecular Formula | C7H11N3S |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | [2-(azetidin-1-yl)-1,3-thiazol-5-yl]methanamine |
| SMILES | NCc1cnc(N2CCC2)s1 |
| InChI | InChI=1S/C7H11N3S/c8-4-6-5-9-7(11-6)10-2-1-3-10/h5H,1-4,8H2 |
| InChIKey | VMQGIRHPFBWWKJ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(azetidin-1-yl)-1,3-thiazol-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(azetidin-1-yl)-1,3-thiazol-5-yl]methanamine?
The IUPAC name of [2-(azetidin-1-yl)-1,3-thiazol-5-yl]methanamine (CID 130548481) is [2-(azetidin-1-yl)-1,3-thiazol-5-yl]methanamine.
What is the SMILES notation for [2-(azetidin-1-yl)-1,3-thiazol-5-yl]methanamine?
The canonical SMILES for [2-(azetidin-1-yl)-1,3-thiazol-5-yl]methanamine is NCc1cnc(N2CCC2)s1.
What is the InChIKey of [2-(azetidin-1-yl)-1,3-thiazol-5-yl]methanamine?
The InChIKey is VMQGIRHPFBWWKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3S/c8-4-6-5-9-7(11-6)10-2-1-3-10/h5H,1-4,8H2.
What are the key properties of [2-(azetidin-1-yl)-1,3-thiazol-5-yl]methanamine?
[2-(azetidin-1-yl)-1,3-thiazol-5-yl]methanamine has a molecular weight of 169.25 g/mol, XLogP of 0.81, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(azetidin-1-yl)-1,3-thiazol-5-yl]methanamine is sourced from PubChem (CID 130548481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).