About [2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methanol
[2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methanol (PubChem CID 62754366) has the molecular formula C8H12N2O2S2
and a molecular weight of 232.33 g/mol. Its IUPAC name is [2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methanol.
Molecular Properties
| Compound Name | [2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methanol |
| PubChem CID | 62754366 |
| Molecular Formula | C8H12N2O2S2 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | [2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methanol |
| SMILES | O=S1CCN(c2ncc(CO)s2)CC1 |
| InChI | InChI=1S/C8H12N2O2S2/c11-6-7-5-9-8(13-7)10-1-3-14(12)4-2-10/h5,11H,1-4,6H2 |
| InChIKey | FCZPVQKSJFSJHP-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methanol?
The IUPAC name of [2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methanol (CID 62754366) is [2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methanol.
What is the SMILES notation for [2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methanol?
The canonical SMILES for [2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methanol is O=S1CCN(c2ncc(CO)s2)CC1.
What is the InChIKey of [2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methanol?
The InChIKey is FCZPVQKSJFSJHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S2/c11-6-7-5-9-8(13-7)10-1-3-14(12)4-2-10/h5,11H,1-4,6H2.
What are the key properties of [2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methanol?
[2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methanol has a molecular weight of 232.33 g/mol, XLogP of 0.20, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methanol is sourced from PubChem (CID 62754366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).