C12H21N3OS — CID 55116778
[2-(4-butan-2-ylpiperazin-1-yl)-1,3-thiazol-5-yl]methanol (PubChem CID 55116778) has the molecular formula C12H21N3OS and a molecular weight of 255.39 g/mol. Its IUPAC name is [2-(4-butan-2-ylpiperazin-1-yl)-1,3-thiazol-5-yl]methanol.
| Compound Name | [2-(4-butan-2-ylpiperazin-1-yl)-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 55116778 |
| Molecular Formula | C12H21N3OS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | [2-(4-butan-2-ylpiperazin-1-yl)-1,3-thiazol-5-yl]methanol |
| SMILES | CCC(C)N1CCN(c2ncc(CO)s2)CC1 |
| InChI | InChI=1S/C12H21N3OS/c1-3-10(2)14-4-6-15(7-5-14)12-13-8-11(9-16)17-12/h8,10,16H,3-7,9H2,1-2H3 |
| InChIKey | MAGRLDAXPASMDS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |