C13H21N3O2S — CID 80576803
2-[2-(4-butan-2-ylpiperazin-1-yl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 80576803) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is 2-[2-(4-butan-2-ylpiperazin-1-yl)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-(4-butan-2-ylpiperazin-1-yl)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 80576803 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-[2-(4-butan-2-ylpiperazin-1-yl)-1,3-thiazol-4-yl]acetic acid |
| SMILES | CCC(C)N1CCN(c2nc(CC(=O)O)cs2)CC1 |
| InChI | InChI=1S/C13H21N3O2S/c1-3-10(2)15-4-6-16(7-5-15)13-14-11(9-19-13)8-12(17)18/h9-10H,3-8H2,1-2H3,(H,17,18) |
| InChIKey | XHWIFULEDCDWDB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |