2-[2-(3-ethoxypiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid

C12H18N2O3S — CID 80575700

IUPAC2-[2-(3-ethoxypiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid
SMILESCCOC1CCCN(c2nc(CC(=O)O)cs2)C1
InChIInChI=1S/C12H18N2O3S/c1-2-17-10-4-3-5-14(7-10)12-13-9(8-18-12)6-11(15)16/h8,10H,2-7H2,1H3,(H,15,16)
InChIKeyNQPSVIGABDGPIB-UHFFFAOYSA-N
MW270.35 g/mol
LogP1.78
Rot. Bonds5

About 2-[2-(3-ethoxypiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid

2-[2-(3-ethoxypiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 80575700) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 2-[2-(3-ethoxypiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[2-(3-ethoxypiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid
PubChem CID80575700
Molecular FormulaC12H18N2O3S
Molecular Weight270.35 g/mol
Exact Mass270.10
IUPAC Name2-[2-(3-ethoxypiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid
SMILESCCOC1CCCN(c2nc(CC(=O)O)cs2)C1
InChIInChI=1S/C12H18N2O3S/c1-2-17-10-4-3-5-14(7-10)12-13-9(8-18-12)6-11(15)16/h8,10H,2-7H2,1H3,(H,15,16)
InChIKeyNQPSVIGABDGPIB-UHFFFAOYSA-N
XLogP1.78
TPSA62.66 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.35
LogP ≤ 51.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[2-(3-ethoxypiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(3-ethoxypiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-[2-(3-ethoxypiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid (CID 80575700) is 2-[2-(3-ethoxypiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-[2-(3-ethoxypiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-[2-(3-ethoxypiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid is CCOC1CCCN(c2nc(CC(=O)O)cs2)C1.
What is the InChIKey of 2-[2-(3-ethoxypiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid?
The InChIKey is NQPSVIGABDGPIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O3S/c1-2-17-10-4-3-5-14(7-10)12-13-9(8-18-12)6-11(15)16/h8,10H,2-7H2,1H3,(H,15,16).
What are the key properties of 2-[2-(3-ethoxypiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid?
2-[2-(3-ethoxypiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid has a molecular weight of 270.35 g/mol, XLogP of 1.78, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3-ethoxypiperidin-1-yl)-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 80575700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).