C9H12N2O2S2 — CID 80575369
2-(2-thiomorpholin-4-yl-1,3-thiazol-4-yl)acetic acid (PubChem CID 80575369) has the molecular formula C9H12N2O2S2 and a molecular weight of 244.34 g/mol. Its IUPAC name is 2-(2-thiomorpholin-4-yl-1,3-thiazol-4-yl)acetic acid.
| Compound Name | 2-(2-thiomorpholin-4-yl-1,3-thiazol-4-yl)acetic acid |
|---|---|
| PubChem CID | 80575369 |
| Molecular Formula | C9H12N2O2S2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 2-(2-thiomorpholin-4-yl-1,3-thiazol-4-yl)acetic acid |
| SMILES | O=C(O)Cc1csc(N2CCSCC2)n1 |
| InChI | InChI=1S/C9H12N2O2S2/c12-8(13)5-7-6-15-9(10-7)11-1-3-14-4-2-11/h6H,1-5H2,(H,12,13) |
| InChIKey | BGGCSTDFRLJWOW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |