About 1-phenyl-2-[2-(1,4-thiazepan-4-yl)-1,3-thiazol-4-yl]ethanone
1-phenyl-2-[2-(1,4-thiazepan-4-yl)-1,3-thiazol-4-yl]ethanone (PubChem CID 62751666) has the molecular formula C16H18N2OS2
and a molecular weight of 318.47 g/mol. Its IUPAC name is 1-phenyl-2-[2-(1,4-thiazepan-4-yl)-1,3-thiazol-4-yl]ethanone.
Molecular Properties
| Compound Name | 1-phenyl-2-[2-(1,4-thiazepan-4-yl)-1,3-thiazol-4-yl]ethanone |
| PubChem CID | 62751666 |
| Molecular Formula | C16H18N2OS2 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 1-phenyl-2-[2-(1,4-thiazepan-4-yl)-1,3-thiazol-4-yl]ethanone |
| SMILES | O=C(Cc1csc(N2CCCSCC2)n1)c1ccccc1 |
| InChI | InChI=1S/C16H18N2OS2/c19-15(13-5-2-1-3-6-13)11-14-12-21-16(17-14)18-7-4-9-20-10-8-18/h1-3,5-6,12H,4,7-11H2 |
| InChIKey | BOEPGVSUBIADCB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-phenyl-2-[2-(1,4-thiazepan-4-yl)-1,3-thiazol-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-2-[2-(1,4-thiazepan-4-yl)-1,3-thiazol-4-yl]ethanone?
The IUPAC name of 1-phenyl-2-[2-(1,4-thiazepan-4-yl)-1,3-thiazol-4-yl]ethanone (CID 62751666) is 1-phenyl-2-[2-(1,4-thiazepan-4-yl)-1,3-thiazol-4-yl]ethanone.
What is the SMILES notation for 1-phenyl-2-[2-(1,4-thiazepan-4-yl)-1,3-thiazol-4-yl]ethanone?
The canonical SMILES for 1-phenyl-2-[2-(1,4-thiazepan-4-yl)-1,3-thiazol-4-yl]ethanone is O=C(Cc1csc(N2CCCSCC2)n1)c1ccccc1.
What is the InChIKey of 1-phenyl-2-[2-(1,4-thiazepan-4-yl)-1,3-thiazol-4-yl]ethanone?
The InChIKey is BOEPGVSUBIADCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2OS2/c19-15(13-5-2-1-3-6-13)11-14-12-21-16(17-14)18-7-4-9-20-10-8-18/h1-3,5-6,12H,4,7-11H2.
What are the key properties of 1-phenyl-2-[2-(1,4-thiazepan-4-yl)-1,3-thiazol-4-yl]ethanone?
1-phenyl-2-[2-(1,4-thiazepan-4-yl)-1,3-thiazol-4-yl]ethanone has a molecular weight of 318.47 g/mol, XLogP of 3.51, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-2-[2-(1,4-thiazepan-4-yl)-1,3-thiazol-4-yl]ethanone is sourced from PubChem (CID 62751666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).