C9H12N2O2S — CID 62967092
2-(1,4-oxazepan-4-yl)-1,3-thiazole-5-carbaldehyde (PubChem CID 62967092) has the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. Its IUPAC name is 2-(1,4-oxazepan-4-yl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-(1,4-oxazepan-4-yl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 62967092 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 2-(1,4-oxazepan-4-yl)-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1cnc(N2CCCOCC2)s1 |
| InChI | InChI=1S/C9H12N2O2S/c12-7-8-6-10-9(14-8)11-2-1-4-13-5-3-11/h6-7H,1-5H2 |
| InChIKey | AKSATTYHVCMQDA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|