C8H11N3O2S — CID 15398953
N-(5-morpholin-4-yl-1,3-thiazol-2-yl)formamide (PubChem CID 15398953) has the molecular formula C8H11N3O2S and a molecular weight of 213.26 g/mol. Its IUPAC name is N-(5-morpholin-4-yl-1,3-thiazol-2-yl)formamide.
| Compound Name | N-(5-morpholin-4-yl-1,3-thiazol-2-yl)formamide |
|---|---|
| PubChem CID | 15398953 |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | N-(5-morpholin-4-yl-1,3-thiazol-2-yl)formamide |
| SMILES | O=CNc1ncc(N2CCOCC2)s1 |
| InChI | InChI=1S/C8H11N3O2S/c12-6-10-8-9-5-7(14-8)11-1-3-13-4-2-11/h5-6H,1-4H2,(H,9,10,12) |
| InChIKey | PASCIVCCTVXYPJ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|