About 4-(2-ethyl-1,3-thiazol-5-yl)morpholine
4-(2-ethyl-1,3-thiazol-5-yl)morpholine (PubChem CID 89317794) has the molecular formula C9H14N2OS
and a molecular weight of 198.29 g/mol. Its IUPAC name is 4-(2-ethyl-1,3-thiazol-5-yl)morpholine.
Molecular Properties
| Compound Name | 4-(2-ethyl-1,3-thiazol-5-yl)morpholine |
| PubChem CID | 89317794 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 4-(2-ethyl-1,3-thiazol-5-yl)morpholine |
| SMILES | CCc1ncc(N2CCOCC2)s1 |
| InChI | InChI=1S/C9H14N2OS/c1-2-8-10-7-9(13-8)11-3-5-12-6-4-11/h7H,2-6H2,1H3 |
| InChIKey | AFDBLHZBCIOJGJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-ethyl-1,3-thiazol-5-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-ethyl-1,3-thiazol-5-yl)morpholine?
The IUPAC name of 4-(2-ethyl-1,3-thiazol-5-yl)morpholine (CID 89317794) is 4-(2-ethyl-1,3-thiazol-5-yl)morpholine.
What is the SMILES notation for 4-(2-ethyl-1,3-thiazol-5-yl)morpholine?
The canonical SMILES for 4-(2-ethyl-1,3-thiazol-5-yl)morpholine is CCc1ncc(N2CCOCC2)s1.
What is the InChIKey of 4-(2-ethyl-1,3-thiazol-5-yl)morpholine?
The InChIKey is AFDBLHZBCIOJGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2OS/c1-2-8-10-7-9(13-8)11-3-5-12-6-4-11/h7H,2-6H2,1H3.
What are the key properties of 4-(2-ethyl-1,3-thiazol-5-yl)morpholine?
4-(2-ethyl-1,3-thiazol-5-yl)morpholine has a molecular weight of 198.29 g/mol, XLogP of 1.54, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-ethyl-1,3-thiazol-5-yl)morpholine is sourced from PubChem (CID 89317794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).