C12H21N3OS — CID 54883121
N-[(2-ethyl-1,3-thiazol-5-yl)methyl]-2-morpholin-4-ylethanamine (PubChem CID 54883121) has the molecular formula C12H21N3OS and a molecular weight of 255.39 g/mol. Its IUPAC name is N-[(2-ethyl-1,3-thiazol-5-yl)methyl]-2-morpholin-4-ylethanamine.
| Compound Name | N-[(2-ethyl-1,3-thiazol-5-yl)methyl]-2-morpholin-4-ylethanamine |
|---|---|
| PubChem CID | 54883121 |
| Molecular Formula | C12H21N3OS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | N-[(2-ethyl-1,3-thiazol-5-yl)methyl]-2-morpholin-4-ylethanamine |
| SMILES | CCc1ncc(CNCCN2CCOCC2)s1 |
| InChI | InChI=1S/C12H21N3OS/c1-2-12-14-10-11(17-12)9-13-3-4-15-5-7-16-8-6-15/h10,13H,2-9H2,1H3 |
| InChIKey | QLPZLLVOEDLHKV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|