C11H17N3O2S — CID 113246126
N-[(5-ethyl-1,3-thiazol-2-yl)methyl]morpholine-4-carboxamide (PubChem CID 113246126) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is N-[(5-ethyl-1,3-thiazol-2-yl)methyl]morpholine-4-carboxamide.
| Compound Name | N-[(5-ethyl-1,3-thiazol-2-yl)methyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 113246126 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | N-[(5-ethyl-1,3-thiazol-2-yl)methyl]morpholine-4-carboxamide |
| SMILES | CCc1cnc(CNC(=O)N2CCOCC2)s1 |
| InChI | InChI=1S/C11H17N3O2S/c1-2-9-7-12-10(17-9)8-13-11(15)14-3-5-16-6-4-14/h7H,2-6,8H2,1H3,(H,13,15) |
| InChIKey | CLVXEBBOUVXNKK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |