C12H9N5OS — CID 15425577
2-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethene-1,1,2-tricarbonitrile (PubChem CID 15425577) has the molecular formula C12H9N5OS and a molecular weight of 271.31 g/mol. Its IUPAC name is 2-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 15425577 |
| Molecular Formula | C12H9N5OS |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 2-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)c1cnc(N2CCOCC2)s1 |
| InChI | InChI=1S/C12H9N5OS/c13-5-9(6-14)10(7-15)11-8-16-12(19-11)17-1-3-18-4-2-17/h8H,1-4H2 |
| InChIKey | VQYVUKYQKWETCL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 96.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|