About 4-[[4-(5-formyl-1,3-thiazol-2-yl)piperazin-1-yl]methyl]benzonitrile
4-[[4-(5-formyl-1,3-thiazol-2-yl)piperazin-1-yl]methyl]benzonitrile (PubChem CID 88990060) has the molecular formula C16H16N4OS
and a molecular weight of 312.40 g/mol. Its IUPAC name is 4-[[4-(5-formyl-1,3-thiazol-2-yl)piperazin-1-yl]methyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[[4-(5-formyl-1,3-thiazol-2-yl)piperazin-1-yl]methyl]benzonitrile |
| PubChem CID | 88990060 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 4-[[4-(5-formyl-1,3-thiazol-2-yl)piperazin-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2CCN(c3ncc(C=O)s3)CC2)cc1 |
| InChI | InChI=1S/C16H16N4OS/c17-9-13-1-3-14(4-2-13)11-19-5-7-20(8-6-19)16-18-10-15(12-21)22-16/h1-4,10,12H,5-8,11H2 |
| InChIKey | LOBLSOACRVOXAJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-[[4-(5-formyl-1,3-thiazol-2-yl)piperazin-1-yl]methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(5-formyl-1,3-thiazol-2-yl)piperazin-1-yl]methyl]benzonitrile?
The IUPAC name of 4-[[4-(5-formyl-1,3-thiazol-2-yl)piperazin-1-yl]methyl]benzonitrile (CID 88990060) is 4-[[4-(5-formyl-1,3-thiazol-2-yl)piperazin-1-yl]methyl]benzonitrile.
What is the SMILES notation for 4-[[4-(5-formyl-1,3-thiazol-2-yl)piperazin-1-yl]methyl]benzonitrile?
The canonical SMILES for 4-[[4-(5-formyl-1,3-thiazol-2-yl)piperazin-1-yl]methyl]benzonitrile is N#Cc1ccc(CN2CCN(c3ncc(C=O)s3)CC2)cc1.
What is the InChIKey of 4-[[4-(5-formyl-1,3-thiazol-2-yl)piperazin-1-yl]methyl]benzonitrile?
The InChIKey is LOBLSOACRVOXAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4OS/c17-9-13-1-3-14(4-2-13)11-19-5-7-20(8-6-19)16-18-10-15(12-21)22-16/h1-4,10,12H,5-8,11H2.
What are the key properties of 4-[[4-(5-formyl-1,3-thiazol-2-yl)piperazin-1-yl]methyl]benzonitrile?
4-[[4-(5-formyl-1,3-thiazol-2-yl)piperazin-1-yl]methyl]benzonitrile has a molecular weight of 312.40 g/mol, XLogP of 2.15, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(5-formyl-1,3-thiazol-2-yl)piperazin-1-yl]methyl]benzonitrile is sourced from PubChem (CID 88990060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).