C12H16N4O2S — CID 47147013
4-[(4-cyanophenyl)methyl]piperazine-1-sulfonamide (PubChem CID 47147013) has the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is 4-[(4-cyanophenyl)methyl]piperazine-1-sulfonamide.
| Compound Name | 4-[(4-cyanophenyl)methyl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 47147013 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 4-[(4-cyanophenyl)methyl]piperazine-1-sulfonamide |
| SMILES | N#Cc1ccc(CN2CCN(S(N)(=O)=O)CC2)cc1 |
| InChI | InChI=1S/C12H16N4O2S/c13-9-11-1-3-12(4-2-11)10-15-5-7-16(8-6-15)19(14,17)18/h1-4H,5-8,10H2,(H2,14,17,18) |
| InChIKey | DQOJZLAGYKSJAB-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 90.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |