C14H20N2S — CID 131976859
4-[(1,1-dimethyl-1,4-thiazinan-4-yl)methyl]benzonitrile (PubChem CID 131976859) has the molecular formula C14H20N2S and a molecular weight of 248.40 g/mol. Its IUPAC name is 4-[(1,1-dimethyl-1,4-thiazinan-4-yl)methyl]benzonitrile.
| Compound Name | 4-[(1,1-dimethyl-1,4-thiazinan-4-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 131976859 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.40 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 4-[(1,1-dimethyl-1,4-thiazinan-4-yl)methyl]benzonitrile |
| SMILES | CS1(C)CCN(Cc2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C14H20N2S/c1-17(2)9-7-16(8-10-17)12-14-5-3-13(11-15)4-6-14/h3-6H,7-10,12H2,1-2H3 |
| InChIKey | REZVZVNHQZZMDK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |