C16H17N3O2S2 — CID 26545215
4-[4-(thiophen-3-ylmethyl)piperazin-1-yl]sulfonylbenzonitrile (PubChem CID 26545215) has the molecular formula C16H17N3O2S2 and a molecular weight of 347.46 g/mol. Its IUPAC name is 4-[4-(thiophen-3-ylmethyl)piperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 4-[4-(thiophen-3-ylmethyl)piperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 26545215 |
| Molecular Formula | C16H17N3O2S2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 4-[4-(thiophen-3-ylmethyl)piperazin-1-yl]sulfonylbenzonitrile |
| SMILES | N#Cc1ccc(S(=O)(=O)N2CCN(Cc3ccsc3)CC2)cc1 |
| InChI | InChI=1S/C16H17N3O2S2/c17-11-14-1-3-16(4-2-14)23(20,21)19-8-6-18(7-9-19)12-15-5-10-22-13-15/h1-5,10,13H,6-9,12H2 |
| InChIKey | ICOYPDJOWRPQPJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |