C18H17ClFN3O2S — CID 51178795
4-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]sulfonylbenzonitrile (PubChem CID 51178795) has the molecular formula C18H17ClFN3O2S and a molecular weight of 393.87 g/mol. Its IUPAC name is 4-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 4-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 51178795 |
| Molecular Formula | C18H17ClFN3O2S |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 4-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]sulfonylbenzonitrile |
| SMILES | N#Cc1ccc(S(=O)(=O)N2CCN(Cc3c(F)cccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C18H17ClFN3O2S/c19-17-2-1-3-18(20)16(17)13-22-8-10-23(11-9-22)26(24,25)15-6-4-14(12-21)5-7-15/h1-7H,8-11,13H2 |
| InChIKey | BNTMRYFZFCKUSJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |