C19H20ClFN2O2S — CID 8748784
1-[(2-chloro-6-fluorophenyl)methyl]-4-[(E)-2-phenylethenyl]sulfonylpiperazine (PubChem CID 8748784) has the molecular formula C19H20ClFN2O2S and a molecular weight of 394.90 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl]-4-[(E)-2-phenylethenyl]sulfonylpiperazine.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl]-4-[(E)-2-phenylethenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 8748784 |
| Molecular Formula | C19H20ClFN2O2S |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl]-4-[(E)-2-phenylethenyl]sulfonylpiperazine |
| SMILES | O=S(=O)(/C=C/c1ccccc1)N1CCN(Cc2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C19H20ClFN2O2S/c20-18-7-4-8-19(21)17(18)15-22-10-12-23(13-11-22)26(24,25)14-9-16-5-2-1-3-6-16/h1-9,14H,10-13,15H2/b14-9+ |
| InChIKey | IXTIDUAIOQYHLT-NTEUORMPSA-N |
| XLogP | 3.60 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |