C14H19ClN2O2S — CID 78687053
1-[2-(4-chlorophenyl)ethenylsulfonyl]-4-ethylpiperazine (PubChem CID 78687053) has the molecular formula C14H19ClN2O2S and a molecular weight of 314.84 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)ethenylsulfonyl]-4-ethylpiperazine.
| Compound Name | 1-[2-(4-chlorophenyl)ethenylsulfonyl]-4-ethylpiperazine |
|---|---|
| PubChem CID | 78687053 |
| Molecular Formula | C14H19ClN2O2S |
| Molecular Weight | 314.84 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 1-[2-(4-chlorophenyl)ethenylsulfonyl]-4-ethylpiperazine |
| SMILES | CCN1CCN(S(=O)(=O)C=Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C14H19ClN2O2S/c1-2-16-8-10-17(11-9-16)20(18,19)12-7-13-3-5-14(15)6-4-13/h3-7,12H,2,8-11H2,1H3 |
| InChIKey | CTWUELKGVVBTBM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.84 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |