C23H29ClN4O2S — CID 70280894
1-[[1-[2-(4-chlorophenyl)ethenylsulfonyl]piperidin-4-yl]methyl]-4-pyridin-4-ylpiperazine (PubChem CID 70280894) has the molecular formula C23H29ClN4O2S and a molecular weight of 461.03 g/mol. Its IUPAC name is 1-[[1-[2-(4-chlorophenyl)ethenylsulfonyl]piperidin-4-yl]methyl]-4-pyridin-4-ylpiperazine.
| Compound Name | 1-[[1-[2-(4-chlorophenyl)ethenylsulfonyl]piperidin-4-yl]methyl]-4-pyridin-4-ylpiperazine |
|---|---|
| PubChem CID | 70280894 |
| Molecular Formula | C23H29ClN4O2S |
| Molecular Weight | 461.03 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 1-[[1-[2-(4-chlorophenyl)ethenylsulfonyl]piperidin-4-yl]methyl]-4-pyridin-4-ylpiperazine |
| SMILES | O=S(=O)(C=Cc1ccc(Cl)cc1)N1CCC(CN2CCN(c3ccncc3)CC2)CC1 |
| InChI | InChI=1S/C23H29ClN4O2S/c24-22-3-1-20(2-4-22)9-18-31(29,30)28-12-7-21(8-13-28)19-26-14-16-27(17-15-26)23-5-10-25-11-6-23/h1-6,9-11,18,21H,7-8,12-17,19H2 |
| InChIKey | UATFYVKSHAIVRB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.03 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |