C17H16Cl2FN3O4S — CID 55565525
1-[(2-chloro-6-fluorophenyl)methyl]-4-(4-chloro-2-nitrophenyl)sulfonylpiperazine (PubChem CID 55565525) has the molecular formula C17H16Cl2FN3O4S and a molecular weight of 448.30 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl]-4-(4-chloro-2-nitrophenyl)sulfonylpiperazine.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl]-4-(4-chloro-2-nitrophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 55565525 |
| Molecular Formula | C17H16Cl2FN3O4S |
| Molecular Weight | 448.30 g/mol |
| Exact Mass | 447.02 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl]-4-(4-chloro-2-nitrophenyl)sulfonylpiperazine |
| SMILES | O=[N+]([O-])c1cc(Cl)ccc1S(=O)(=O)N1CCN(Cc2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C17H16Cl2FN3O4S/c18-12-4-5-17(16(10-12)23(24)25)28(26,27)22-8-6-21(7-9-22)11-13-14(19)2-1-3-15(13)20/h1-5,10H,6-9,11H2 |
| InChIKey | DOMWRSXTYTWTLK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|