C19H17ClFN3O4S — CID 56587283
5-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]sulfonylisoindole-1,3-dione (PubChem CID 56587283) has the molecular formula C19H17ClFN3O4S and a molecular weight of 437.88 g/mol. Its IUPAC name is 5-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]sulfonylisoindole-1,3-dione.
| Compound Name | 5-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]sulfonylisoindole-1,3-dione |
|---|---|
| PubChem CID | 56587283 |
| Molecular Formula | C19H17ClFN3O4S |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | 5-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]sulfonylisoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2cc(S(=O)(=O)N3CCN(Cc4c(F)cccc4Cl)CC3)ccc21 |
| InChI | InChI=1S/C19H17ClFN3O4S/c20-16-2-1-3-17(21)15(16)11-23-6-8-24(9-7-23)29(27,28)12-4-5-13-14(10-12)19(26)22-18(13)25/h1-5,10H,6-9,11H2,(H,22,25,26) |
| InChIKey | XQQKNTCCPFLAKM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|