C16H17FN2O4S2 — CID 45292563
2-fluoro-5-[4-(thiophen-3-ylmethyl)piperazin-1-yl]sulfonylbenzoic acid (PubChem CID 45292563) has the molecular formula C16H17FN2O4S2 and a molecular weight of 384.45 g/mol. Its IUPAC name is 2-fluoro-5-[4-(thiophen-3-ylmethyl)piperazin-1-yl]sulfonylbenzoic acid.
| Compound Name | 2-fluoro-5-[4-(thiophen-3-ylmethyl)piperazin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 45292563 |
| Molecular Formula | C16H17FN2O4S2 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 2-fluoro-5-[4-(thiophen-3-ylmethyl)piperazin-1-yl]sulfonylbenzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)N2CCN(Cc3ccsc3)CC2)ccc1F |
| InChI | InChI=1S/C16H17FN2O4S2/c17-15-2-1-13(9-14(15)16(20)21)25(22,23)19-6-4-18(5-7-19)10-12-3-8-24-11-12/h1-3,8-9,11H,4-7,10H2,(H,20,21) |
| InChIKey | AUWAYDMUEHWJCR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |