C20H25N3O3S2 — CID 9181425
(3-pyrrolidin-1-ylsulfonylphenyl)-[4-(thiophen-3-ylmethyl)piperazin-1-yl]methanone (PubChem CID 9181425) has the molecular formula C20H25N3O3S2 and a molecular weight of 419.57 g/mol. Its IUPAC name is (3-pyrrolidin-1-ylsulfonylphenyl)-[4-(thiophen-3-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | (3-pyrrolidin-1-ylsulfonylphenyl)-[4-(thiophen-3-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 9181425 |
| Molecular Formula | C20H25N3O3S2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | (3-pyrrolidin-1-ylsulfonylphenyl)-[4-(thiophen-3-ylmethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cccc(S(=O)(=O)N2CCCC2)c1)N1CCN(Cc2ccsc2)CC1 |
| InChI | InChI=1S/C20H25N3O3S2/c24-20(22-11-9-21(10-12-22)15-17-6-13-27-16-17)18-4-3-5-19(14-18)28(25,26)23-7-1-2-8-23/h3-6,13-14,16H,1-2,7-12,15H2 |
| InChIKey | KUBMVGNYEYUOQG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |