C8H13N3O — CID 130831688
1-(1H-imidazol-2-yl)piperidin-4-ol (PubChem CID 130831688) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 1-(1H-imidazol-2-yl)piperidin-4-ol.
| Compound Name | 1-(1H-imidazol-2-yl)piperidin-4-ol |
|---|---|
| PubChem CID | 130831688 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 1-(1H-imidazol-2-yl)piperidin-4-ol |
| SMILES | OC1CCN(c2ncc[nH]2)CC1 |
| InChI | InChI=1S/C8H13N3O/c12-7-1-5-11(6-2-7)8-9-3-4-10-8/h3-4,7,12H,1-2,5-6H2,(H,9,10) |
| InChIKey | RFXJLZBFPVWTNY-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |