C10H18N4 — CID 131162497
1-ethyl-4-(1H-imidazol-2-yl)-2-methylpiperazine (PubChem CID 131162497) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-ethyl-4-(1H-imidazol-2-yl)-2-methylpiperazine.
| Compound Name | 1-ethyl-4-(1H-imidazol-2-yl)-2-methylpiperazine |
|---|---|
| PubChem CID | 131162497 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 1-ethyl-4-(1H-imidazol-2-yl)-2-methylpiperazine |
| SMILES | CCN1CCN(c2ncc[nH]2)CC1C |
| InChI | InChI=1S/C10H18N4/c1-3-13-6-7-14(8-9(13)2)10-11-4-5-12-10/h4-5,9H,3,6-8H2,1-2H3,(H,11,12) |
| InChIKey | LMGWWZFRXNFOMG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |