C12H18O — CID 130875381
(6R,8S,8aS)-3,8-dimethyl-1,2,6,7,8,8a-hexahydroazulen-6-ol (PubChem CID 130875381) has the molecular formula C12H18O and a molecular weight of 178.28 g/mol. Its IUPAC name is (6R,8S,8aS)-3,8-dimethyl-1,2,6,7,8,8a-hexahydroazulen-6-ol.
| Compound Name | (6R,8S,8aS)-3,8-dimethyl-1,2,6,7,8,8a-hexahydroazulen-6-ol |
|---|---|
| PubChem CID | 130875381 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (6R,8S,8aS)-3,8-dimethyl-1,2,6,7,8,8a-hexahydroazulen-6-ol |
| SMILES | CC1=C2C=C[C@H](O)C[C@H](C)[C@@H]2CC1 |
| InChI | InChI=1S/C12H18O/c1-8-3-5-12-9(2)7-10(13)4-6-11(8)12/h4,6,9-10,12-13H,3,5,7H2,1-2H3/t9-,10-,12-/m0/s1 |
| InChIKey | CWUUHVVFWOOVRN-NHCYSSNCSA-N |
| XLogP | 2.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |