C12H14O — CID 10986775
(1S,4S)-4-(2-methylphenyl)cyclopent-2-en-1-ol (PubChem CID 10986775) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is (1S,4S)-4-(2-methylphenyl)cyclopent-2-en-1-ol.
| Compound Name | (1S,4S)-4-(2-methylphenyl)cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 10986775 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (1S,4S)-4-(2-methylphenyl)cyclopent-2-en-1-ol |
| SMILES | Cc1ccccc1[C@@H]1C=C[C@@H](O)C1 |
| InChI | InChI=1S/C12H14O/c1-9-4-2-3-5-12(9)10-6-7-11(13)8-10/h2-7,10-11,13H,8H2,1H3/t10-,11-/m1/s1 |
| InChIKey | YFFZHQYYMNWOEI-GHMZBOCLSA-N |
| XLogP | 2.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|