C17H20N2O — CID 40777521
(1S,4R)-4-[3,5-dimethyl-1-(2-methylphenyl)pyrazol-4-yl]cyclopent-2-en-1-ol (PubChem CID 40777521) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is (1S,4R)-4-[3,5-dimethyl-1-(2-methylphenyl)pyrazol-4-yl]cyclopent-2-en-1-ol.
| Compound Name | (1S,4R)-4-[3,5-dimethyl-1-(2-methylphenyl)pyrazol-4-yl]cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 40777521 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (1S,4R)-4-[3,5-dimethyl-1-(2-methylphenyl)pyrazol-4-yl]cyclopent-2-en-1-ol |
| SMILES | Cc1ccccc1-n1nc(C)c([C@H]2C=C[C@@H](O)C2)c1C |
| InChI | InChI=1S/C17H20N2O/c1-11-6-4-5-7-16(11)19-13(3)17(12(2)18-19)14-8-9-15(20)10-14/h4-9,14-15,20H,10H2,1-3H3/t14-,15+/m0/s1 |
| InChIKey | ZNBYVGUUSRBXSK-LSDHHAIUSA-N |
| XLogP | 3.20 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|