C23H25N5O2S — CID 163141175
2-[3,5-dimethyl-4-[4-(phenylcarbamothioylamino)cyclopent-2-en-1-yl]pyrazol-1-yl]-N-hydroxybenzeneamine oxide (PubChem CID 163141175) has the molecular formula C23H25N5O2S and a molecular weight of 435.55 g/mol. Its IUPAC name is 2-[3,5-dimethyl-4-[4-(phenylcarbamothioylamino)cyclopent-2-en-1-yl]pyrazol-1-yl]-N-hydroxybenzeneamine oxide.
| Compound Name | 2-[3,5-dimethyl-4-[4-(phenylcarbamothioylamino)cyclopent-2-en-1-yl]pyrazol-1-yl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163141175 |
| Molecular Formula | C23H25N5O2S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 2-[3,5-dimethyl-4-[4-(phenylcarbamothioylamino)cyclopent-2-en-1-yl]pyrazol-1-yl]-N-hydroxybenzeneamine oxide |
| SMILES | Cc1nn(-c2ccccc2[NH+]([O-])O)c(C)c1C1C=CC(NC(=S)Nc2ccccc2)C1 |
| InChI | InChI=1S/C23H25N5O2S/c1-15-22(16(2)27(26-15)20-10-6-7-11-21(20)28(29)30)17-12-13-19(14-17)25-23(31)24-18-8-4-3-5-9-18/h3-13,17,19,28-29H,14H2,1-2H3,(H2,24,25,31) |
| InChIKey | JVGSMOGGNWUIBB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|