C28H34N4O — CID 26743431
1-benzyl-3-[(1S,4S)-4-[1-(4-tert-butylphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]urea (PubChem CID 26743431) has the molecular formula C28H34N4O and a molecular weight of 442.61 g/mol. Its IUPAC name is 1-benzyl-3-[(1S,4S)-4-[1-(4-tert-butylphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]urea.
| Compound Name | 1-benzyl-3-[(1S,4S)-4-[1-(4-tert-butylphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]urea |
|---|---|
| PubChem CID | 26743431 |
| Molecular Formula | C28H34N4O |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | 1-benzyl-3-[(1S,4S)-4-[1-(4-tert-butylphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]urea |
| SMILES | Cc1nn(-c2ccc(C(C)(C)C)cc2)c(C)c1[C@@H]1C=C[C@@H](NC(=O)NCc2ccccc2)C1 |
| InChI | InChI=1S/C28H34N4O/c1-19-26(20(2)32(31-19)25-15-12-23(13-16-25)28(3,4)5)22-11-14-24(17-22)30-27(33)29-18-21-9-7-6-8-10-21/h6-16,22,24H,17-18H2,1-5H3,(H2,29,30,33)/t22-,24-/m1/s1 |
| InChIKey | CCEXGLXGJOOQKJ-ISKFKSNPSA-N |
| XLogP | 5.70 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|