C27H32FN3 — CID 74735034
4-[1-(4-tert-butylphenyl)-3,5-dimethylpyrazol-4-yl]-N-[(4-fluorophenyl)methyl]cyclopent-2-en-1-amine (PubChem CID 74735034) has the molecular formula C27H32FN3 and a molecular weight of 417.57 g/mol. Its IUPAC name is 4-[1-(4-tert-butylphenyl)-3,5-dimethylpyrazol-4-yl]-N-[(4-fluorophenyl)methyl]cyclopent-2-en-1-amine.
| Compound Name | 4-[1-(4-tert-butylphenyl)-3,5-dimethylpyrazol-4-yl]-N-[(4-fluorophenyl)methyl]cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 74735034 |
| Molecular Formula | C27H32FN3 |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | 4-[1-(4-tert-butylphenyl)-3,5-dimethylpyrazol-4-yl]-N-[(4-fluorophenyl)methyl]cyclopent-2-en-1-amine |
| SMILES | Cc1nn(-c2ccc(C(C)(C)C)cc2)c(C)c1C1C=CC(NCc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C27H32FN3/c1-18-26(19(2)31(30-18)25-14-9-22(10-15-25)27(3,4)5)21-8-13-24(16-21)29-17-20-6-11-23(28)12-7-20/h6-15,21,24,29H,16-17H2,1-5H3 |
| InChIKey | JZQVKLAYEZBOJV-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|