C22H24N4 — CID 74735015
N-benzyl-4-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)cyclopent-2-en-1-amine (PubChem CID 74735015) has the molecular formula C22H24N4 and a molecular weight of 344.46 g/mol. Its IUPAC name is N-benzyl-4-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)cyclopent-2-en-1-amine.
| Compound Name | N-benzyl-4-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 74735015 |
| Molecular Formula | C22H24N4 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | N-benzyl-4-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)cyclopent-2-en-1-amine |
| SMILES | Cc1nn(-c2ccccn2)c(C)c1C1C=CC(NCc2ccccc2)C1 |
| InChI | InChI=1S/C22H24N4/c1-16-22(17(2)26(25-16)21-10-6-7-13-23-21)19-11-12-20(14-19)24-15-18-8-4-3-5-9-18/h3-13,19-20,24H,14-15H2,1-2H3 |
| InChIKey | XAOZGQSKBAMKAZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|