C23H23BrFN3 — CID 40780469
(1S,4S)-4-[1-(3-bromophenyl)-3,5-dimethylpyrazol-4-yl]-N-[(4-fluorophenyl)methyl]cyclopent-2-en-1-amine (PubChem CID 40780469) has the molecular formula C23H23BrFN3 and a molecular weight of 440.36 g/mol. Its IUPAC name is (1S,4S)-4-[1-(3-bromophenyl)-3,5-dimethylpyrazol-4-yl]-N-[(4-fluorophenyl)methyl]cyclopent-2-en-1-amine.
| Compound Name | (1S,4S)-4-[1-(3-bromophenyl)-3,5-dimethylpyrazol-4-yl]-N-[(4-fluorophenyl)methyl]cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 40780469 |
| Molecular Formula | C23H23BrFN3 |
| Molecular Weight | 440.36 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | (1S,4S)-4-[1-(3-bromophenyl)-3,5-dimethylpyrazol-4-yl]-N-[(4-fluorophenyl)methyl]cyclopent-2-en-1-amine |
| SMILES | Cc1nn(-c2cccc(Br)c2)c(C)c1[C@@H]1C=C[C@@H](NCc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C23H23BrFN3/c1-15-23(16(2)28(27-15)22-5-3-4-19(24)13-22)18-8-11-21(12-18)26-14-17-6-9-20(25)10-7-17/h3-11,13,18,21,26H,12,14H2,1-2H3/t18-,21-/m1/s1 |
| InChIKey | CXGGMKJTNVUDBU-WIYYLYMNSA-N |
| XLogP | 5.59 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.36 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|