C24H23FN4 — CID 163149128
3-[[[(1S,4R)-4-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]amino]methyl]benzonitrile (PubChem CID 163149128) has the molecular formula C24H23FN4 and a molecular weight of 386.47 g/mol. Its IUPAC name is 3-[[[(1S,4R)-4-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]amino]methyl]benzonitrile.
| Compound Name | 3-[[[(1S,4R)-4-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 163149128 |
| Molecular Formula | C24H23FN4 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 3-[[[(1S,4R)-4-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]amino]methyl]benzonitrile |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(C)c1[C@H]1C=C[C@@H](NCc2cccc(C#N)c2)C1 |
| InChI | InChI=1S/C24H23FN4/c1-16-24(17(2)29(28-16)23-10-7-21(25)8-11-23)20-6-9-22(13-20)27-15-19-5-3-4-18(12-19)14-26/h3-12,20,22,27H,13,15H2,1-2H3/t20-,22+/m0/s1 |
| InChIKey | MRSDTIAZPXHTFT-RBBKRZOGSA-N |
| XLogP | 4.70 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|