C21H22BrN3O — CID 74451241
4-[1-(3-bromophenyl)-3,5-dimethylpyrazol-4-yl]-N-(furan-2-ylmethyl)cyclopent-2-en-1-amine (PubChem CID 74451241) has the molecular formula C21H22BrN3O and a molecular weight of 412.33 g/mol. Its IUPAC name is 4-[1-(3-bromophenyl)-3,5-dimethylpyrazol-4-yl]-N-(furan-2-ylmethyl)cyclopent-2-en-1-amine.
| Compound Name | 4-[1-(3-bromophenyl)-3,5-dimethylpyrazol-4-yl]-N-(furan-2-ylmethyl)cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 74451241 |
| Molecular Formula | C21H22BrN3O |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 4-[1-(3-bromophenyl)-3,5-dimethylpyrazol-4-yl]-N-(furan-2-ylmethyl)cyclopent-2-en-1-amine |
| SMILES | Cc1nn(-c2cccc(Br)c2)c(C)c1C1C=CC(NCc2ccco2)C1 |
| InChI | InChI=1S/C21H22BrN3O/c1-14-21(15(2)25(24-14)19-6-3-5-17(22)12-19)16-8-9-18(11-16)23-13-20-7-4-10-26-20/h3-10,12,16,18,23H,11,13H2,1-2H3 |
| InChIKey | AVWKGOPLAKMQRG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|