C23H24BrN3 — CID 163168317
(1S,4R)-N-benzyl-4-[1-(3-bromophenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-amine (PubChem CID 163168317) has the molecular formula C23H24BrN3 and a molecular weight of 422.37 g/mol. Its IUPAC name is (1S,4R)-N-benzyl-4-[1-(3-bromophenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-amine.
| Compound Name | (1S,4R)-N-benzyl-4-[1-(3-bromophenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 163168317 |
| Molecular Formula | C23H24BrN3 |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | (1S,4R)-N-benzyl-4-[1-(3-bromophenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-amine |
| SMILES | Cc1nn(-c2cccc(Br)c2)c(C)c1[C@H]1C=C[C@@H](NCc2ccccc2)C1 |
| InChI | InChI=1S/C23H24BrN3/c1-16-23(17(2)27(26-16)22-10-6-9-20(24)14-22)19-11-12-21(13-19)25-15-18-7-4-3-5-8-18/h3-12,14,19,21,25H,13,15H2,1-2H3/t19-,21+/m0/s1 |
| InChIKey | UIADSYHWCSUSNI-PZJWPPBQSA-N |
| XLogP | 5.45 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|